On Target FYN_HUMAN 0.29090908/CHEMBL1221512
For the given ligand Rofecoxib, we have found in our database that, being scored 0.29090908, the most similar ligand is CHEMBL1221512. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL1221512 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | CC[C@H](C)[C@@H](CO[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(=O)(=O)C)C(=O)OC(C)C)NC[C@@H](N)CS |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00000040 05005200 00300100 80110740 000800c0 02002200 00000000 20000040 84000800 000848c0 08302000 4008f000 06018002 04040002 803c1008 180c1008 1c821000 82000000 04400008 00000201 40010120 38000e03 13000301 0244001c 38000c00 80000000 00800000 10000001 08000200 0006002b 20004000 03012620 |