On Target FYN_HUMAN 0.35148516/CHEMBL1221512
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.35148516, the most similar ligand is CHEMBL1221512. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL1221512 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | CC[C@H](C)[C@@H](CO[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(=O)(=O)C)C(=O)OC(C)C)NC[C@@H](N)CS |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 00000040 05005200 00300100 80110740 000800c0 02002200 00000000 20000040 84000800 000848c0 08302000 4008f000 06018002 04040002 803c1008 180c1008 1c821000 82000000 04400008 00000201 40010120 38000e03 13000301 0244001c 38000c00 80000000 00800000 10000001 08000200 0006002b 20004000 03012620 |