On Target CAH2_HUMAN 0.4642857/CHEMBL355555
For the given ligand Amantadine, we have found in our database that, being scored 0.4642857, the most similar ligand is CHEMBL355555. Check out the elaboration below.
| Amantadine (Given Ligand) | CHEMBL355555 (Similar Ligand) |
|---|---|
| NC23CC1CC(CC(C1)C2)C3 | NS(=O)(=O)NC1C2CC3CC(CC1C3)C2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000080 00000000 40010000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 10000010 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00000020 01000000 02000000 01200400 00000000 00000000 00000000 00000000 00000000 00000080 00002000 40010000 00000000 00000001 00400000 00000000 00000000 00000000 02002000 00004001 00000000 10000010 00000000 10800010 00000000 00000000 00000000 00000010 00000000 40040000 00020000 00010060 |