On Target CAH2_HUMAN 0.44210526/CHEMBL419006
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.44210526, the most similar ligand is CHEMBL419006. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL419006 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CCCC(CCC)C(=O)OCCc1ccc(cc1)S(=O)(=O)N |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00010050 01801000 01000100 00b10300 00080048 00000000 00000000 00000040 00000000 00080840 08002000 60009000 04008000 00000001 80240000 00081008 08820000 02000000 04402000 00002001 80010020 08040a00 01000000 08400018 00000400 80000000 00000000 00000028 00000200 20020002 00020000 00010420 |