On Target CAH2_HUMAN 0.3968254/CHEMBL170725
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.3968254, the most similar ligand is CHEMBL170725. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL170725 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | CC1(C)OC[C@@H]2O[C@]3(OC(C)(C)O[C@H]3[C@@H]2O1)C(=O)NS(=O)(=O)N |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 00050020 05000000 02000000 81a10500 003c0040 00200004 20803800 08001040 00282000 010000a0 00002000 4001d000 14008028 03880001 01481000 282b9008 04a00000 80800100 11c0a000 08004005 00100020 10000610 07000000 58900054 10001420 00000000 00000200 24000030 10000202 40040000 00e00000 00010260 |