On Target CAH2_HUMAN 0.37671232/CHEMBL183450
For the given ligand Alfentanil, we have found in our database that, being scored 0.37671232, the most similar ligand is CHEMBL183450. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL183450 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | NS(=O)(=O)c1ccc(NC(=O)CCCCN2CCOCC2)cc1 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00014012 01802000 01100000 80b00600 20000090 00002000 00000000 20000008 00000000 000008c0 00282004 60019000 04008012 00100001 802a1048 00080108 10040000 00000000 08000000 00002201 c0100000 18000620 32002000 08500018 00000400 00000000 00000000 100000c9 00008200 20060001 00000000 00010220 |