On Target CDK5_HUMAN 0.29139072/CHEMBL1996176
For the given ligand Rofecoxib, we have found in our database that, being scored 0.29139072, the most similar ligand is CHEMBL1996176. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL1996176 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | O=C1Nc2ccccc2C1=Cc3ccc[nH]3 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00004202 00008000 00100100 10010e00 20000021 04000000 80000080 08024408 01800000 00480840 08280104 60009008 01008000 00110002 c0020142 00040004 20040400 12000104 08218000 00800000 40100000 18208600 20822000 81410011 00000000 82000201 00402010 40011280 04408004 00060003 24002200 20000600 |