On Target PTGES_HUMAN 0.39041096/CHEMBL2071516
For the given ligand Rofecoxib, we have found in our database that, being scored 0.39041096, the most similar ligand is CHEMBL2071516. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL2071516 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | OC1OC(=O)C(=C1c2ccc(cc2)C(=O)Nc3ccccc3)Br |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00004002 04008820 00000100 c0810e00 00000140 00000000 800000a0 02001440 01800100 00180864 48280004 4000c800 84008900 00100000 00041042 00280008 08060410 02800000 0c018018 00000000 41110c20 08028e00 21012000 00400014 00001400 80001000 00402000 e0000580 00408300 00060003 8c040008 00800610 |