On Target PTGES_HUMAN 0.35514018/CHEMBL3919693
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.35514018, the most similar ligand is CHEMBL3919693. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL3919693 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CC1(C)CN(CC[C@H]1C(=O)N[C@H]2CCC[C@H](CO)C2)c3ccc(cc3)C(F)(F)F |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00024002 01001800 00100100 00010600 20180000 00002000 00000400 20000000 00200000 000008d0 00200004 50039000 04008002 01808000 00020040 00080008 00040000 02000000 0a402000 00000201 40100000 18040610 21000000 00500018 00000000 80000000 00000200 90000080 00008000 00060001 00120000 00802a00 |