On Target MIF_HUMAN 0.3138686/CHEMBL497598
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.3138686, the most similar ligand is CHEMBL497598. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL497598 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CC(C)(C)OC(=O)C[C@H]1CC(=NO1)c2ccc(O)c(F)c2 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00010000 01000008 20900102 02050b00 02080040 10440010 02000040 00002000 00108948 03092851 08110000 50009000 9400880a 00a01000 00000008 00091018 00820800 02000000 01406000 00860441 00000120 28008a00 01001042 00400010 00000400 80020004 e0120000 02000001 0010420a 00028002 40080000 00000600 |