On Target 5HT2B_HUMAN 0.3559322/CHEMBL521805
For the given ligand Rofecoxib, we have found in our database that, being scored 0.3559322, the most similar ligand is CHEMBL521805. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL521805 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | O=S(=O)(c1ccccc1)c2ccc3CCNCCc3c2 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00000000 00c01200 00122100 00910600 00040120 00010000 00000000 00000001 00800080 00080840 08202000 60808000 00000002 00210000 80200080 00000000 04001200 02100000 00200000 00002200 88000000 18240000 00804020 89400019 00000000 80000000 00000000 00000020 04000200 00060002 00000000 00012621 |