On Target 5HT2B_HUMAN 0.5638298/CHEMBL1277769
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.5638298, the most similar ligand is CHEMBL1277769. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL1277769 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CC1(CCN(CC1)C2CCC3(C2)Cc4ccccc4Cc5ccccc35)C(=O)O |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00020000 01000200 00100102 00010600 00100000 00000002 00000400 21000001 04100800 000808c0 08300000 50019000 04008002 00200000 00000020 020c0008 00000000 02000000 00502000 00000201 00000100 18100a10 01404000 00500810 00000000 a0000001 00000000 50000000 02000082 0106000a 00020000 00802f00 |