On Target HRH1_HUMAN 0.31111112/CHEMBL908
For the given ligand Rofecoxib, we have found in our database that, being scored 0.31111112, the most similar ligand is CHEMBL908. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL908 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | CN(C)CC\C=C/1\c2ccccc2Sc3ccc(Cl)cc13 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00008000 0c800200 00120300 00110600 00062000 08100020 84080080 01004402 00000080 00180844 08200400 60008800 0a000004 00000001 80000002 00000000 04001400 02000044 00200000 00000000 80000000 18000100 00808000 00400019 01002000 a4000000 10402000 40001000 00400280 00070f02 04000000 00030620 |