On Target HRH1_HUMAN 0.5952381/CHEMBL914
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.5952381, the most similar ligand is CHEMBL914. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL914 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CC(C)(C(=O)O)c1ccc(cc1)C(O)CCCN2CCC(CC2)C(O)(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 01000000 00100102 00050600 00100040 00004000 00000000 21000000 00100900 000808c0 08300000 50019800 01008002 00200000 40040000 00080008 08000000 02000000 00400000 00000201 00000100 18000a20 01000000 00500010 00000000 a0000000 00000000 50000000 00000080 00060002 40002000 00002e00 |