On Target NMDE1_HUMAN 0.13414635/CHEMBL284237
For the given ligand Alfentanil, we have found in our database that, being scored 0.13414635, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |