On Target PGH1_SHEEP 0.34848484/CHEMBL229957
For the given ligand Morphine, we have found in our database that, being scored 0.34848484, the most similar ligand is CHEMBL229957. Check out the elaboration below.
| Morphine (Given Ligand) | CHEMBL229957 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2[C@@H](O)/C=C\[C@H]3[C@H]4C5 | COc1ccc2C=C(CCc2c1)c3ccc(OC)c(OC)c3OC |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000002 02081000 38000643 00000890 001818ca 08300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 04492010 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f40 | 00080001 43000008 2000030a 00110200 20201000 40040000 c2040080 00000600 00000804 00180842 08102100 40108040 00024002 20200000 01000023 0002a00a 04000400 02000004 10080000 00020a01 00100100 18000000 0000c021 00400410 01000000 c0000001 00522000 c0000000 00400300 0002410b 04000000 00010500 |