On Target DRD4_HUMAN 0.43636364/CHEMBL24809
For the given ligand Celecoxib, we have found in our database that, being scored 0.43636364, the most similar ligand is CHEMBL24809. Check out the elaboration below.
| Celecoxib (Given Ligand) | CHEMBL24809 (Similar Ligand) |
|---|---|
| Cc3ccc(c1cc(C(F)(F)F)nn1c2ccc(S(N)(=O)=O)cc2)cc3 | Cc1cc(c2ccccc2)n(n1)C3CCN(Cc4ccccc4)CC3 |
|
|
|
|
|
|
| 00006036 00802208 a1100100 00b10600 01080010 00004002 00440400 00001400 00000104 000108f0 0900a004 6000800a 00000810 02000201 80200040 000c200c 00020000 02801000 04400000 10222008 c0100000 1801a020 30800800 8b404008 00000000 c0000040 30c20000 90000869 04004104 20460008 40260200 800126a2 | 00006004 01000408 a0100100 00010600 21180000 00002002 00440000 22001000 00200000 000009c0 00200008 70018000 00001812 00840000 00020400 000c200c 00120000 02801000 04400000 00220201 80100000 1801a010 31800801 02504018 00000000 c0000000 10020004 90000061 01004104 00060010 200c0200 00000a6a |