On Target CXCR4_HUMAN 0.3377193/CHEMBL2029611
For the given ligand Codeine, we have found in our database that, being scored 0.3377193, the most similar ligand is CHEMBL2029611. Check out the elaboration below.
| Codeine (Given Ligand) | CHEMBL2029611 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3/C=C\[C@H](O)[C@@H]4Oc1c2[C@]34CCN5C | C\C\1=C(\C)/[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccc3ccccc3c2)C(=O)NCC(=O)N[C@@H]1Cc4ccc(O)cc4 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000002 020c1000 38000643 00000890 001818ca 08300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 04492010 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f40 | 00010010 0900b208 21900102 04110e00 00000000 00000000 02180040 2000240e 00200ac0 001808ca 08300000 4103b000 06029112 00212001 80000400 00140308 20000000 02000140 00012008 00021201 00000100 38250638 00008003 83500018 00200800 80000000 405a4000 90000100 0c000010 0006040b ac084000 00012600 |