On Target OPRX_HUMAN 0.9385475/CHEMBL3262362
For the given ligand Codeine, we have found in our database that, being scored 0.9385475, the most similar ligand is CHEMBL3262362. Check out the elaboration below.
| Codeine (Given Ligand) | CHEMBL3262362 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3/C=C\[C@H](O)[C@@H]4Oc1c2[C@]34CCN5C | CC[C@](O)([C@H]1C[C@]23C=C[C@]1(OC)[C@@H]4Oc5c(O)ccc6C[C@H]2N(CC7CC7)CC[C@@]34c56)C(C)(C)C |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000002 020c1000 38000643 00000890 001818ca 08300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 04492010 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f40 | 04001000 cb000208 20100d0a 80310700 00381061 c2000802 02081000 38000643 00002890 011818ca 48300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 17492012 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f50 |