On Target NS3_HCV1A 0.34567901/CHEMBL4107728
For the given ligand Ibuprofen, we have found in our database that, being scored 0.34567901, the most similar ligand is CHEMBL4107728. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL4107728 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CC[C@@H](N)c1ccc(C)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000040 00000800 00100100 02010600 00000201 00008010 00000400 01001000 00000900 00082e40 08100000 50008a00 80008840 00201000 00000000 08080008 03000200 02000000 00000400 00000001 00000100 18028200 01004000 10400014 00000000 a0000000 08000000 40800001 02000080 00068002 80040000 00000600 |