|
Name | Acetylsalicylic acid |
2D and 3D depictions | |
SMILES | CC(=O)Oc1ccccc1C(=O)O |
Model downloads | |
Fingerprints |
Name | Indomethacin |
2D and 3D depictions | |
SMILES | COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 |
Model downloads | |
Fingerprints |
Name | Ibuprofen |
2D and 3D depictions | |
SMILES | CC(C)Cc1ccc(C(C)C(=O)O)cc1 |
Model downloads | |
Fingerprints |
Name | Fenbufen |
2D and 3D depictions | |
SMILES | O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 |
Model downloads | |
Fingerprints |
Name | Ritonavir |
2D and 3D depictions | |
SMILES | CC(C)c4nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)C(C)C)cs4 |
Model downloads | |
Fingerprints |