On Target NS3_HCV1B 0.16759777/CHEMBL3954962
For the given ligand Fenbufen, we have found in our database that, being scored 0.16759777, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |