On Target NS3_HCV1B 0.32954547/CHEMBL1170417
For the given ligand Indomethacin, we have found in our database that, being scored 0.32954547, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |