On Target RT_HIV1 0.33212996/CHEMBL3900871
For the given ligand Indomethacin, we have found in our database that, being scored 0.33212996, the most similar ligand is CHEMBL3900871. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL3900871 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | CC(C)CN(C(CO)c1ccc(CNC(=O)C(NC(=O)c2ccccc2)C(c2ccccc2)c2cn(C)c3ccccc23)s1)S(=O)(=O)c1ccc2ncsc2c1 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 08038012 10803a00 03180108 45b10611 100c52c0 00028000 04006881 2300d00e 00460980 004918c0 09302a04 f001b880 9e20a832 00442821 806c24c0 080c160c 18413020 8291008c 00700418 00006e0d c0001900 782a8698 23900201 db41005c 42043800 ec010104 48000800 d000200c 0c200780 2006000f a0044200 00c107e0 |