On Target NS5B_HCV1B 0.21428572/CHEMBL213832
For the given ligand Fenbufen, we have found in our database that, being scored 0.21428572, the most similar ligand is CHEMBL213832. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL213832 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CN(C)C(=O)Cn1c(-c2ccccc2)c(C2CCCCC2)c2sc(C(=O)O)cc21 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 000360c2 2d001801 00100912 51810618 201e5121 0000c100 00002080 00094004 20600900 100808c0 08300a04 4003a080 88008818 00e09801 204a3d20 0c0c000c 11134000 c280209c 06202400 00514013 00102100 78868ef0 30904080 90500016 0a842001 c4000009 08010000 90000044 0a044c06 00061453 c0020a40 00c11e20 |