On Target NS5B_HCV1B 0.3586498/CHEMBL3645208
For the given ligand Indomethacin, we have found in our database that, being scored 0.3586498, the most similar ligand is CHEMBL3645208. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL3645208 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | CNC(=O)c1c2cc(C3CC3)c(N(CCCO)S(C)(=O)=O)cc2nn1-c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0000c006 00805e08 20180902 41310e00 210c0000 00004042 02040000 02001408 00100900 004908c0 09312024 40118800 82008c27 01400201 810a0040 000e200e 04268000 02400604 08e00008 00224205 c0100101 1c838f38 21800880 9360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |