On Target NP_HCoV-OC43 0.094339624/CHEMBL3233481
For the given ligand Fenbufen, we have found in our database that, being scored 0.094339624, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |