On Target PLP_SARS 0.38260868/CHEMBL213054
For the given ligand Ritonavir, we have found in our database that, being scored 0.38260868, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Ritonavir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(C)c4nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)C(C)C)cs4 | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0103000a 01407000 1010090a 34010e10 000800c2 00128002 00002084 2001f00f 10600b80 004a08c0 08318a00 f003b000 0400b052 00212001 00022000 001e002c 0002c010 020804a0 00c12850 8100ca41 80002900 783d1ed0 231000c9 9351001c 02051001 8c008802 00200001 90221004 0c081206 04061003 a0024000 a0092601 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |