On Target NSP1_SARS 0.4185022/CHEMBL2441745
For the given ligand Ritonavir, we have found in our database that, being scored 0.4185022, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Ritonavir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CC(C)c4nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)C(C)C)cs4 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 0103000a 01407000 1010090a 34010e10 000800c2 00128002 00002084 2001f00f 10600b80 004a08c0 08318a00 f003b000 0400b052 00212001 00022000 001e002c 0002c010 020804a0 00c12850 8100ca41 80002900 783d1ed0 231000c9 9351001c 02051001 8c008802 00200001 90221004 0c081206 04061003 a0024000 a0092601 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |