On Target NS3_HCV1A 0.4125874/CHEMBL296588
For the given ligand Lopinavir, we have found in our database that, being scored 0.4125874, the most similar ligand is CHEMBL296588. Check out the elaboration below.
| Lopinavir (Given Ligand) | CHEMBL296588 (Similar Ligand) |
|---|---|
| Cc1cccc(C)c1OCC(=O)N[C@@H](Cc2ccccc2)[C@@H](O)C[C@H](Cc3ccccc3)NC(=O)[C@H](C(C)C)N4CCCNC4=O | CC(C)CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)O)C(C)C)C(C)C |
|
|
|
|
|
|
| 04012000 01007408 2010010a 04010e02 00081081 00000000 02000004 2000200c 00210880 000a09e0 08340000 4003f000 0780b002 00202000 81281001 00082008 10000010 82028000 00c02040 00020201 00000100 383d0610 130000c1 83500018 00010001 80000000 00000008 10000001 0c000302 00060013 20024000 00002600 | 00030000 01007000 00100000 04000400 00180080 00000000 00000000 20000008 00200000 00000080 00200000 40033000 1600800a 00802001 80180000 00080008 10000000 00000000 01c02000 00000201 00000000 30040e10 03000083 02100018 00000001 00000000 00000000 10000000 08000000 00040001 20024000 00802a00 |