|
Name | Lopinavir |
2D and 3D depictions | |
SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc2ccccc2)[C@@H](O)C[C@H](Cc3ccccc3)NC(=O)[C@H](C(C)C)N4CCCNC4=O |
Model downloads | |
Fingerprints |
Name | Cobicistat |
2D and 3D depictions | |
SMILES | CC(C)c5nc(CN(C)C(=O)N[C@@H](CCN1CCOCC1)C(=O)N[C@H](CC[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)Cc4ccccc4)cs5 |
Model downloads | |
Fingerprints |
Name | Lisinopril |
2D and 3D depictions | |
SMILES | NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O |
Model downloads | |
Fingerprints |
Name | Ramipril |
2D and 3D depictions | |
SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 |
Model downloads | |
Fingerprints |
Name | Moexipril |
2D and 3D depictions | |
SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O |
Model downloads | |
Fingerprints |