On Target NS3_HCV1A 0.3910891/CHEMBL3645744
For the given ligand Moexipril, we have found in our database that, being scored 0.3910891, the most similar ligand is CHEMBL3645744. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3645744 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)CN1CCc3ccccc3C1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 000180a8 09003000 06100100 15210600 00000020 00000010 000a0000 22001408 10000080 0019c9c8 08602000 4001b000 0601889a 01202011 a0400400 00000000 04004200 02000020 46012000 00004201 00020000 38248630 00004003 b3d00038 00000000 c0000000 00004000 90000010 0c000100 c0060083 64064004 00012660 |