On Target NS3_HCV1B 0.37908497/CHEMBL3921185
For the given ligand Lopinavir, we have found in our database that, being scored 0.37908497, the most similar ligand is CHEMBL3921185. Check out the elaboration below.
| Lopinavir (Given Ligand) | CHEMBL3921185 (Similar Ligand) |
|---|---|
| Cc1cccc(C)c1OCC(=O)N[C@@H](Cc2ccccc2)[C@@H](O)C[C@H](Cc3ccccc3)NC(=O)[C@H](C(C)C)N4CCCNC4=O | C=CC(=O)NC[C@H](NC(=O)NC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 04012000 01007408 2010010a 04010e02 00081081 00000000 02000004 2000200c 00210880 000a09e0 08340000 4003f000 0780b002 00202000 81281001 00082008 10000010 82028000 00c02040 00020201 00000100 383d0610 130000c1 83500018 00010001 80000000 00000008 10000001 0c000302 00060013 20024000 00002600 | 00010000 01003400 00100000 04000c00 00000000 00000010 00000004 20002408 05000000 000201a0 00200000 50013000 0e00a01a 01012011 80000000 00000000 00000010 00000101 00002050 00001201 00000100 300d0630 00000003 02100018 00001000 00000000 00080000 10000000 08000000 00040011 24024000 02002200 |