On Target PA_INFA 0.384/CHEMBL2040554
For the given ligand Lisinopril, we have found in our database that, being scored 0.384, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |