On Target GP_EBOV 0.41666666/CHEMBL3125897
For the given ligand Ramipril, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |