On Target PR_HIV1 0.35741445/CHEMBL450294
For the given ligand Cobicistat, we have found in our database that, being scored 0.35741445, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Cobicistat (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| CC(C)c5nc(CN(C)C(=O)N[C@@H](CCN1CCOCC1)C(=O)N[C@H](CC[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)Cc4ccccc4)cs5 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 0103000a 01403400 1010090a b4010e10 000000c2 00108002 00002084 2001f00f 10600b80 004a09e0 08318a00 f003b000 0400b052 00212001 000a3008 001e012c 1002c010 020804a0 00012850 8100ca41 80002900 782d1ed0 32100009 9351001c 02051400 8c008802 00200001 90221005 0c081206 04061013 a0124000 a0892601 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |