On Target PR_HIV1 0.3756906/CHEMBL494500
For the given ligand Ramipril, we have found in our database that, being scored 0.3756906, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |