On Target RT_HIV1 0.46715328/CHEMBL4224769
For the given ligand Ramipril, we have found in our database that, being scored 0.46715328, the most similar ligand is CHEMBL4224769. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL4224769 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | C=C(C)[C@@H]1CC[C@]2(CNCCN3CCOCC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00000000 01000800 00100302 c4050600 00000080 00004000 80000080 20000402 00000900 001808c0 08300000 40018800 00028002 00202000 0010140a 00080108 10000400 02000020 02012000 00000201 01000100 38020a30 12008021 02500014 01200400 80000000 00406000 d0000001 08400202 01060002 e4020000 00000600 |