On Target NS5B_HCV1A 0.385/CHEMBL68034
For the given ligand Moexipril, we have found in our database that, being scored 0.385, the most similar ligand is CHEMBL68034. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL68034 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CC(C)COC(=O)N[C@H](C(=O)N1C[C@H](c2ccccc2)C[C@H]1C(=O)N[C@@H](CC(F)F)C(=O)NCCc1c(F)cc(C(=O)O)cc1F)C(C)C |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00010000 01403a00 00100102 46050600 00000400 0001c010 00000000 2004000c 00900b80 000928c0 08300000 d001b800 0e008012 00203101 80000000 001e0408 010a0200 02080000 00000810 00000201 00000100 38260e30 01002003 c350001c 00000000 80001082 00000060 90200021 0c000200 0406800b e0004000 00402600 |