On Target NS5B_HCV1B 0.37662336/CHEMBL3422106
For the given ligand Cobicistat, we have found in our database that, being scored 0.37662336, the most similar ligand is CHEMBL3422106. Check out the elaboration below.
| Cobicistat (Given Ligand) | CHEMBL3422106 (Similar Ligand) |
|---|---|
| CC(C)c5nc(CN(C)C(=O)N[C@@H](CCN1CCOCC1)C(=O)N[C@H](CC[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)Cc4ccccc4)cs5 | CC(C)N1CCC(N(C)C(=O)Cn2c(-c3ccccc3)c(C3CCCCC3)c3sc(C(=O)O)cc32)C1 |
|
|
|
|
|
|
| 0103000a 01403400 1010090a b4010e10 000000c2 00108002 00002084 2001f00f 10600b80 004a09e0 08318a00 f003b000 0400b052 00212001 000a3008 001e012c 1002c010 020804a0 00012850 8100ca41 80002900 782d1ed0 32100009 9351001c 02051400 8c008802 00200001 90221005 0c081206 04061013 a0124000 a0892601 | 000360c2 2d003c01 00100912 55810618 201e5121 0000c110 00002080 2009400c 20600900 100809e0 08300a04 4003a080 8800881a 00e0b801 204a3d20 0c0c000c 11134000 c280209c 06202400 00514213 00102100 788e8ef0 30904083 9250001e 0a842001 c4000009 08010000 90000044 0a044c06 00061453 c0020a40 00c11e20 |