On Target NS5B_HCV1B 0.2962963/CHEMBL3422106
For the given ligand Lopinavir, we have found in our database that, being scored 0.2962963, the most similar ligand is CHEMBL3422106. Check out the elaboration below.
| Lopinavir (Given Ligand) | CHEMBL3422106 (Similar Ligand) |
|---|---|
| Cc1cccc(C)c1OCC(=O)N[C@@H](Cc2ccccc2)[C@@H](O)C[C@H](Cc3ccccc3)NC(=O)[C@H](C(C)C)N4CCCNC4=O | CC(C)N1CCC(N(C)C(=O)Cn2c(-c3ccccc3)c(C3CCCCC3)c3sc(C(=O)O)cc32)C1 |
|
|
|
|
|
|
| 04012000 01007408 2010010a 04010e02 00081081 00000000 02000004 2000200c 00210880 000a09e0 08340000 4003f000 0780b002 00202000 81281001 00082008 10000010 82028000 00c02040 00020201 00000100 383d0610 130000c1 83500018 00010001 80000000 00000008 10000001 0c000302 00060013 20024000 00002600 | 000360c2 2d003c01 00100912 55810618 201e5121 0000c110 00002080 2009400c 20600900 100809e0 08300a04 4003a080 8800881a 00e0b801 204a3d20 0c0c000c 11134000 c280209c 06202400 00514213 00102100 788e8ef0 30904083 9250001e 0a842001 c4000009 08010000 90000044 0a044c06 00061453 c0020a40 00c11e20 |