On Target NA_INFB 0.3580247/CHEMBL373336
For the given ligand Cobicistat, we have found in our database that, being scored 0.3580247, the most similar ligand is CHEMBL373336. Check out the elaboration below.
| Cobicistat (Given Ligand) | CHEMBL373336 (Similar Ligand) |
|---|---|
| CC(C)c5nc(CN(C)C(=O)N[C@@H](CCN1CCOCC1)C(=O)N[C@H](CC[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)Cc4ccccc4)cs5 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1nccs1 |
|
|
|
|
|
|
| 0103000a 01403400 1010090a b4010e10 000000c2 00108002 00002084 2001f00f 10600b80 004a09e0 08318a00 f003b000 0400b052 00212001 000a3008 001e012c 1002c010 020804a0 00012850 8100ca41 80002900 782d1ed0 32100009 9351001c 02051400 8c008802 00200001 90221005 0c081206 04061013 a0124000 a0892601 | 0403000a 01003000 00100020 14080400 00080080 00000010 030000a0 20018008 00000000 00400280 00208a00 d0013000 0600a05a 01802001 831a2000 000c400c 10000000 0c000080 00406018 00000201 20100800 70040eb0 23000001 02110018 02003000 0e000004 00000000 10000384 08000004 00861001 18024000 20812a10 |