On Target NSP15_SARS 0.44052863/CHEMBL2441745
For the given ligand Cobicistat, we have found in our database that, being scored 0.44052863, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Cobicistat (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CC(C)c5nc(CN(C)C(=O)N[C@@H](CCN1CCOCC1)C(=O)N[C@H](CC[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)Cc4ccccc4)cs5 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 0103000a 01403400 1010090a b4010e10 000000c2 00108002 00002084 2001f00f 10600b80 004a09e0 08318a00 f003b000 0400b052 00212001 000a3008 001e012c 1002c010 020804a0 00012850 8100ca41 80002900 782d1ed0 32100009 9351001c 02051400 8c008802 00200001 90221005 0c081206 04061013 a0124000 a0892601 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |