On Target NP_HCoV-OC43 0.11618257/CHEMBL3233481
For the given ligand Cobicistat, we have found in our database that, being scored 0.11618257, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Cobicistat (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)c5nc(CN(C)C(=O)N[C@@H](CCN1CCOCC1)C(=O)N[C@H](CC[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)Cc4ccccc4)cs5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0103000a 01403400 1010090a b4010e10 000000c2 00108002 00002084 2001f00f 10600b80 004a09e0 08318a00 f003b000 0400b052 00212001 000a3008 001e012c 1002c010 020804a0 00012850 8100ca41 80002900 782d1ed0 32100009 9351001c 02051400 8c008802 00200001 90221005 0c081206 04061013 a0124000 a0892601 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |