On Target PR_FCoV 0.1392405/CHEMBL4214066
For the given ligand Tenofovir, we have found in our database that, being scored 0.1392405, the most similar ligand is CHEMBL4214066. Check out the elaboration below.
| Tenofovir (Given Ligand) | CHEMBL4214066 (Similar Ligand) |
|---|---|
| CC(Cn2cnc1c(N)ncnc12)OCP(=O)(O)O | CC(C)C[C@H](NC(=O)OC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000000a 00901800 80080000 48080620 00080041 0000c100 00008002 00000800 00400108 00000080 0000800c 40019000 00001000 00820000 00081080 300ec00c 00200028 00000000 10400000 80200000 80000080 15400050 23800040 04000014 00000000 00000000 00000200 08014030 00000208 00460000 c0080000 000080c4 | 00030000 01403000 00100100 04010600 00000000 00018010 00000001 20000008 00a00200 00020080 00200000 5003b000 0e00801a 00002101 80000000 001a0008 00220000 00080000 00802810 00000201 00000000 30140f70 01000081 02100018 00000001 00001002 00000000 10200020 08000200 00040005 a0004000 00802200 |