On Target PR_FCoV 0.2028302/CHEMBL4214471
For the given ligand Inophinnin, we have found in our database that, being scored 0.2028302, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Inophinnin (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| COc3c(C/C=C(C)\C)cc(O)c4[oH+]c2c1O[C@@H](C)C(C)(C)c1cc(O)c2c(=O)c34 | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 04001001 42000c08 20000108 40218202 00001041 c2820000 42040001 01000640 00140904 00980a40 08100000 40008a40 0080c022 20000080 01044001 2a08a018 08000000 02108004 04082000 00020a01 00400100 08020300 01008020 06420014 00200000 e8000000 005a0800 40a00000 00000380 0002000a 87020400 02000440 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |