|
Name | Pyranojacareubin |
2D and 3D depictions | |
SMILES | CC5(C)/C=C\c4c(cc3[oH+]c2c(O)c1OC(C)(C)/C=C\c1cc2c(=O)c3c4O)O5 |
Model downloads | |
Fingerprints |
Name | Soulattrin |
2D and 3D depictions | |
SMILES | C=CC(C)(C)c3c(O)ccc4c(=O)c2c(O)c1/C=C\C(C)(C)Oc1c(O)c2[oH+]c34 |
Model downloads | |
Fingerprints |
Name | Phylattrin |
2D and 3D depictions | |
SMILES | COc3cc2[oH+]c1c(O)cc(C/C=C(C)\C)c(OC)c1c(=O)c2c(C)c3C/C=C(C)/C |
Model downloads | |
Fingerprints |
Name | Inophinnin |
2D and 3D depictions | |
SMILES | COc3c(C/C=C(C)\C)cc(O)c4[oH+]c2c1O[C@@H](C)C(C)(C)c1cc(O)c2c(=O)c34 |
Model downloads | |
Fingerprints |
Name | Inophinone |
2D and 3D depictions | |
SMILES | C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 |
Model downloads | |
Fingerprints |