On Target PR_FCoV 0.16143498/CHEMBL4214471
For the given ligand Soulattrin, we have found in our database that, being scored 0.16143498, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Soulattrin (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| C=CC(C)(C)c3c(O)ccc4c(=O)c2c(O)c1/C=C\C(C)(C)Oc1c(O)c2[oH+]c34 | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00820000 c2240081 01000600 04040004 00180a40 48040000 40108a00 0680c022 00000000 01000003 2808a008 00000400 02108004 1000201c 00020a00 00440000 08020300 00008021 06420014 01201000 e8000000 005a2808 40a00400 00454380 80220102 87020400 00000410 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |