On Target PR_FCoV 0.1319149/CHEMBL4214471
For the given ligand Inophinone, we have found in our database that, being scored 0.1319149, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Inophinone (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 04000041 00200028 280a0308 04010202 00201201 80800120 c2000081 40000600 060c4004 40980840 48000020 40008000 46808422 00200088 01000003 10082008 00000420 02108040 1800001c 00820800 00040000 0a010008 0020d000 00580010 09201200 c0004401 00522099 4a900400 10416300 81a20802 04000000 00000410 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |