On Target NS3_HCV1A 0.3416149/CHEMBL4107993
For the given ligand Soulattrin, we have found in our database that, being scored 0.3416149, the most similar ligand is CHEMBL4107993. Check out the elaboration below.
| Soulattrin (Given Ligand) | CHEMBL4107993 (Similar Ligand) |
|---|---|
| C=CC(C)(C)c3c(O)ccc4c(=O)c2c(O)c1/C=C\C(C)(C)Oc1c(O)c2[oH+]c34 | CC[C@@H](N)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00820000 c2240081 01000600 04040004 00180a40 48040000 40108a00 0680c022 00000000 01000003 2808a008 00000400 02108004 1000201c 00020a00 00440000 08020300 00008021 06420014 01201000 e8000000 005a2808 40a00400 00454380 80220102 87020400 00000410 | 00000040 00000808 20100108 02010600 00001201 00020010 02040000 01001200 00000800 00088e40 08100000 40008200 00008842 00001000 01000001 08082008 03000200 02000000 00000400 00020001 00000100 18028200 01000000 12400014 00000000 e0000000 08320800 40800001 00000380 00068002 82040010 00000600 |